C43H48N4O7 — CID 10676437
4-[[(4S,5R,6R,7S)-4,7-dibenzyl-3-[(4-cyanophenyl)methyl]-5,6-bis(2-methoxyethoxymethoxy)-2-oxo-1,3-diazepan-1-yl]methyl]benzonitrile (PubChem CID 10676437) has the molecular formula C43H48N4O7 and a molecular weight of 732.88 g/mol. Its IUPAC name is 4-[[(4S,5R,6R,7S)-4,7-dibenzyl-3-[(4-cyanophenyl)methyl]-5,6-bis(2-methoxyethoxymethoxy)-2-oxo-1,3-diazepan-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[(4S,5R,6R,7S)-4,7-dibenzyl-3-[(4-cyanophenyl)methyl]-5,6-bis(2-methoxyethoxymethoxy)-2-oxo-1,3-diazepan-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 10676437 |
| Molecular Formula | C43H48N4O7 |
| Molecular Weight | 732.88 g/mol |
| Exact Mass | 732.35 |
| IUPAC Name | 4-[[(4S,5R,6R,7S)-4,7-dibenzyl-3-[(4-cyanophenyl)methyl]-5,6-bis(2-methoxyethoxymethoxy)-2-oxo-1,3-diazepan-1-yl]methyl]benzonitrile |
| SMILES | COCCOCO[C@H]1[C@H](OCOCCOC)[C@H](Cc2ccccc2)N(Cc2ccc(C#N)cc2)C(=O)N(Cc2ccc(C#N)cc2)[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C43H48N4O7/c1-49-21-23-51-31-53-41-39(25-33-9-5-3-6-10-33)46(29-37-17-13-35(27-44)14-18-37)43(48)47(30-38-19-15-36(28-45)16-20-38)40(26-34-11-7-4-8-12-34)42(41)54-32-52-24-22-50-2/h3-20,39-42H,21-26,29-32H2,1-2H3/t39-,40-,41+,42+/m0/s1 |
| InChIKey | YIBJPPIUGGAJTE-ATUXXYJQSA-N |
| XLogP | 6.10 |
| TPSA | 126.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.88 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|