C35H46N2O6S — CID 59904117
(4R,5S,6S)-1,4,7-tribenzyl-5,6-bis(2-methoxyethoxymethoxy)-2-methylsulfanyl-4,5,6,7-tetrahydro-1,3-diazepine (PubChem CID 59904117) has the molecular formula C35H46N2O6S and a molecular weight of 622.83 g/mol. Its IUPAC name is (4R,5S,6S)-1,4,7-tribenzyl-5,6-bis(2-methoxyethoxymethoxy)-2-methylsulfanyl-4,5,6,7-tetrahydro-1,3-diazepine.
| Compound Name | (4R,5S,6S)-1,4,7-tribenzyl-5,6-bis(2-methoxyethoxymethoxy)-2-methylsulfanyl-4,5,6,7-tetrahydro-1,3-diazepine |
|---|---|
| PubChem CID | 59904117 |
| Molecular Formula | C35H46N2O6S |
| Molecular Weight | 622.83 g/mol |
| Exact Mass | 622.31 |
| IUPAC Name | (4R,5S,6S)-1,4,7-tribenzyl-5,6-bis(2-methoxyethoxymethoxy)-2-methylsulfanyl-4,5,6,7-tetrahydro-1,3-diazepine |
| SMILES | COCCOCO[C@H]1[C@@H](Cc2ccccc2)N=C(SC)N(Cc2ccccc2)C(Cc2ccccc2)[C@@H]1OCOCCOC |
| InChI | InChI=1S/C35H46N2O6S/c1-38-19-21-40-26-42-33-31(23-28-13-7-4-8-14-28)36-35(44-3)37(25-30-17-11-6-12-18-30)32(24-29-15-9-5-10-16-29)34(33)43-27-41-22-20-39-2/h4-18,31-34H,19-27H2,1-3H3/t31-,32?,33+,34+/m1/s1 |
| InChIKey | SLSCPXGXGYLRON-JHQPQIOASA-N |
| XLogP | 5.46 |
| TPSA | 70.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.83 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|