C26H38N2O8S — CID 59032170
(3R,4S,5S,6R)-3,6-dibenzyl-4,5-bis(2-methoxyethoxymethoxy)-1,2,7-thiadiazepane 1,1-dioxide (PubChem CID 59032170) has the molecular formula C26H38N2O8S and a molecular weight of 538.66 g/mol. Its IUPAC name is (3R,4S,5S,6R)-3,6-dibenzyl-4,5-bis(2-methoxyethoxymethoxy)-1,2,7-thiadiazepane 1,1-dioxide.
| Compound Name | (3R,4S,5S,6R)-3,6-dibenzyl-4,5-bis(2-methoxyethoxymethoxy)-1,2,7-thiadiazepane 1,1-dioxide |
|---|---|
| PubChem CID | 59032170 |
| Molecular Formula | C26H38N2O8S |
| Molecular Weight | 538.66 g/mol |
| Exact Mass | 538.23 |
| IUPAC Name | (3R,4S,5S,6R)-3,6-dibenzyl-4,5-bis(2-methoxyethoxymethoxy)-1,2,7-thiadiazepane 1,1-dioxide |
| SMILES | COCCOCO[C@@H]1[C@@H](OCOCCOC)[C@@H](Cc2ccccc2)NS(=O)(=O)N[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C26H38N2O8S/c1-31-13-15-33-19-35-25-23(17-21-9-5-3-6-10-21)27-37(29,30)28-24(18-22-11-7-4-8-12-22)26(25)36-20-34-16-14-32-2/h3-12,23-28H,13-20H2,1-2H3/t23-,24-,25+,26+/m1/s1 |
| InChIKey | YLMICMDHLRHMFZ-XPGKHFPBSA-N |
| XLogP | 1.66 |
| TPSA | 113.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.66 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|