C20H24O4S — CID 11451253
[(1R,2R)-1-(benzenesulfinyl)-2-(2-methoxyethoxymethoxy)cyclopropyl]methylbenzene (PubChem CID 11451253) has the molecular formula C20H24O4S and a molecular weight of 360.48 g/mol. Its IUPAC name is [(1R,2R)-1-(benzenesulfinyl)-2-(2-methoxyethoxymethoxy)cyclopropyl]methylbenzene.
| Compound Name | [(1R,2R)-1-(benzenesulfinyl)-2-(2-methoxyethoxymethoxy)cyclopropyl]methylbenzene |
|---|---|
| PubChem CID | 11451253 |
| Molecular Formula | C20H24O4S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | [(1R,2R)-1-(benzenesulfinyl)-2-(2-methoxyethoxymethoxy)cyclopropyl]methylbenzene |
| SMILES | COCCOCO[C@@H]1C[C@@]1(Cc1ccccc1)S(=O)c1ccccc1 |
| InChI | InChI=1S/C20H24O4S/c1-22-12-13-23-16-24-19-15-20(19,14-17-8-4-2-5-9-17)25(21)18-10-6-3-7-11-18/h2-11,19H,12-16H2,1H3/t19-,20-,25?/m1/s1 |
| InChIKey | OCISAASRGAXISX-PRIXLJELSA-N |
| XLogP | 3.19 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|