C25H44O5SSn — CID 11006336
[(1S,2R)-1-(benzenesulfonyl)-2-(2-methoxyethoxymethoxy)cyclopropyl]-tributylstannane (PubChem CID 11006336) has the molecular formula C25H44O5SSn and a molecular weight of 575.40 g/mol. Its IUPAC name is [(1S,2R)-1-(benzenesulfonyl)-2-(2-methoxyethoxymethoxy)cyclopropyl]-tributylstannane.
| Compound Name | [(1S,2R)-1-(benzenesulfonyl)-2-(2-methoxyethoxymethoxy)cyclopropyl]-tributylstannane |
|---|---|
| PubChem CID | 11006336 |
| Molecular Formula | C25H44O5SSn |
| Molecular Weight | 575.40 g/mol |
| Exact Mass | 576.19 |
| IUPAC Name | [(1S,2R)-1-(benzenesulfonyl)-2-(2-methoxyethoxymethoxy)cyclopropyl]-tributylstannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)[C@@]1(S(=O)(=O)c2ccccc2)C[C@H]1OCOCCOC |
| InChI | InChI=1S/C13H17O5S.3C4H9.Sn/c1-16-7-8-17-10-18-12-9-13(12)19(14,15)11-5-3-2-4-6-11;3*1-3-4-2;/h2-6,12H,7-10H2,1H3;3*1,3-4H2,2H3;/t12-;;;;/m1..../s1 |
| InChIKey | MYAARVHMUWSMNL-HHUWXINPSA-N |
| XLogP | 6.00 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.40 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|