About 2-methoxyethoxymethyl benzoate
2-methoxyethoxymethyl benzoate (PubChem CID 11275823) has the molecular formula C11H14O4
and a molecular weight of 210.23 g/mol. Its IUPAC name is 2-methoxyethoxymethyl benzoate.
Molecular Properties
| Compound Name | 2-methoxyethoxymethyl benzoate |
| PubChem CID | 11275823 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 2-methoxyethoxymethyl benzoate |
| SMILES | COCCOCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C11H14O4/c1-13-7-8-14-9-15-11(12)10-5-3-2-4-6-10/h2-6H,7-9H2,1H3 |
| InChIKey | HFYOCIQOCSXPKH-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxyethoxymethyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxyethoxymethyl benzoate?
The IUPAC name of 2-methoxyethoxymethyl benzoate (CID 11275823) is 2-methoxyethoxymethyl benzoate.
What is the SMILES notation for 2-methoxyethoxymethyl benzoate?
The canonical SMILES for 2-methoxyethoxymethyl benzoate is COCCOCOC(=O)c1ccccc1.
What is the InChIKey of 2-methoxyethoxymethyl benzoate?
The InChIKey is HFYOCIQOCSXPKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O4/c1-13-7-8-14-9-15-11(12)10-5-3-2-4-6-10/h2-6H,7-9H2,1H3.
What are the key properties of 2-methoxyethoxymethyl benzoate?
2-methoxyethoxymethyl benzoate has a molecular weight of 210.23 g/mol, XLogP of 1.46, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyethoxymethyl benzoate is sourced from PubChem (CID 11275823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).