C15H20O3 — CID 15482916
cis-methyl (1S,2R)-2-butoxy-1-phenylcyclopropane-1-carboxylate (PubChem CID 15482916) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is cis-methyl (1S,2R)-2-butoxy-1-phenylcyclopropane-1-carboxylate.
| Compound Name | cis-methyl (1S,2R)-2-butoxy-1-phenylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 15482916 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | cis-methyl (1S,2R)-2-butoxy-1-phenylcyclopropane-1-carboxylate |
| SMILES | CCCCO[C@@H]1C[C@]1(C(=O)OC)c1ccccc1 |
| InChI | InChI=1S/C15H20O3/c1-3-4-10-18-13-11-15(13,14(16)17-2)12-8-6-5-7-9-12/h5-9,13H,3-4,10-11H2,1-2H3/t13-,15+/m1/s1 |
| InChIKey | XABZZYVHRKVJPJ-HIFRSBDPSA-N |
| XLogP | 2.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|