C17H24O5 — CID 15710234
methyl 5-heptyl-3-phenyl-1,2,4-trioxolane-3-carboxylate (PubChem CID 15710234) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is methyl 5-heptyl-3-phenyl-1,2,4-trioxolane-3-carboxylate.
| Compound Name | methyl 5-heptyl-3-phenyl-1,2,4-trioxolane-3-carboxylate |
|---|---|
| PubChem CID | 15710234 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | methyl 5-heptyl-3-phenyl-1,2,4-trioxolane-3-carboxylate |
| SMILES | CCCCCCCC1OOC(C(=O)OC)(c2ccccc2)O1 |
| InChI | InChI=1S/C17H24O5/c1-3-4-5-6-10-13-15-20-17(22-21-15,16(18)19-2)14-11-8-7-9-12-14/h7-9,11-12,15H,3-6,10,13H2,1-2H3 |
| InChIKey | CNOGOIXDRLFLKW-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|