C17H23BO4 — CID 101251411
trans-methyl (1S,2R)-1-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropane-1-carboxylate (PubChem CID 101251411) has the molecular formula C17H23BO4 and a molecular weight of 302.18 g/mol. Its IUPAC name is trans-methyl (1S,2R)-1-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropane-1-carboxylate.
| Compound Name | trans-methyl (1S,2R)-1-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 101251411 |
| Molecular Formula | C17H23BO4 |
| Molecular Weight | 302.18 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | trans-methyl (1S,2R)-1-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropane-1-carboxylate |
| SMILES | COC(=O)[C@@]1(c2ccccc2)C[C@H]1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H23BO4/c1-15(2)16(3,4)22-18(21-15)13-11-17(13,14(19)20-5)12-9-7-6-8-10-12/h6-10,13H,11H2,1-5H3/t13-,17-/m1/s1 |
| InChIKey | RUOKOEIJZACLSC-CXAGYDPISA-N |
| XLogP | 2.96 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.18 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|