C18H27NO3 — CID 70794612
trans-(1R,2S)-2-butoxy-1-[[(1S)-1-phenylethyl]amino]cyclopentane-1-carboxylic acid (PubChem CID 70794612) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is trans-(1R,2S)-2-butoxy-1-[[(1S)-1-phenylethyl]amino]cyclopentane-1-carboxylic acid.
| Compound Name | trans-(1R,2S)-2-butoxy-1-[[(1S)-1-phenylethyl]amino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 70794612 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | trans-(1R,2S)-2-butoxy-1-[[(1S)-1-phenylethyl]amino]cyclopentane-1-carboxylic acid |
| SMILES | CCCCO[C@H]1CCC[C@]1(N[C@@H](C)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C18H27NO3/c1-3-4-13-22-16-11-8-12-18(16,17(20)21)19-14(2)15-9-6-5-7-10-15/h5-7,9-10,14,16,19H,3-4,8,11-13H2,1-2H3,(H,20,21)/t14-,16-,18+/m0/s1 |
| InChIKey | DCAMXJXUMRNYCN-QILLFSRXSA-N |
| XLogP | 3.53 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|