C18H30N2 — CID 65193606
1-(aminomethyl)-N-(1-phenylethyl)-4-propylcyclohexan-1-amine (PubChem CID 65193606) has the molecular formula C18H30N2 and a molecular weight of 274.45 g/mol. Its IUPAC name is 1-(aminomethyl)-N-(1-phenylethyl)-4-propylcyclohexan-1-amine.
| Compound Name | 1-(aminomethyl)-N-(1-phenylethyl)-4-propylcyclohexan-1-amine |
|---|---|
| PubChem CID | 65193606 |
| Molecular Formula | C18H30N2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | 1-(aminomethyl)-N-(1-phenylethyl)-4-propylcyclohexan-1-amine |
| SMILES | CCCC1CCC(CN)(NC(C)c2ccccc2)CC1 |
| InChI | InChI=1S/C18H30N2/c1-3-7-16-10-12-18(14-19,13-11-16)20-15(2)17-8-5-4-6-9-17/h4-6,8-9,15-16,20H,3,7,10-14,19H2,1-2H3 |
| InChIKey | DJWYOAGPMZBXTN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |