C15H23ClO4S — CID 101369116
[1-chloro-3-(2-methoxyethoxymethoxy)-2,2-dimethylpropyl]sulfinylbenzene (PubChem CID 101369116) has the molecular formula C15H23ClO4S and a molecular weight of 334.87 g/mol. Its IUPAC name is [1-chloro-3-(2-methoxyethoxymethoxy)-2,2-dimethylpropyl]sulfinylbenzene.
| Compound Name | [1-chloro-3-(2-methoxyethoxymethoxy)-2,2-dimethylpropyl]sulfinylbenzene |
|---|---|
| PubChem CID | 101369116 |
| Molecular Formula | C15H23ClO4S |
| Molecular Weight | 334.87 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | [1-chloro-3-(2-methoxyethoxymethoxy)-2,2-dimethylpropyl]sulfinylbenzene |
| SMILES | COCCOCOCC(C)(C)C(Cl)S(=O)c1ccccc1 |
| InChI | InChI=1S/C15H23ClO4S/c1-15(2,11-20-12-19-10-9-18-3)14(16)21(17)13-7-5-4-6-8-13/h4-8,14H,9-12H2,1-3H3 |
| InChIKey | BTGDZMMURIFKFB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.87 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|