C37H54N2O5Si2 — CID 10651987
(4R,5S,6S,7R)-4,7-dibenzyl-1,3-bis(prop-2-ynyl)-5,6-bis(2-trimethylsilylethoxymethoxy)-1,3-diazepan-2-one (PubChem CID 10651987) has the molecular formula C37H54N2O5Si2 and a molecular weight of 663.02 g/mol. Its IUPAC name is (4R,5S,6S,7R)-4,7-dibenzyl-1,3-bis(prop-2-ynyl)-5,6-bis(2-trimethylsilylethoxymethoxy)-1,3-diazepan-2-one.
| Compound Name | (4R,5S,6S,7R)-4,7-dibenzyl-1,3-bis(prop-2-ynyl)-5,6-bis(2-trimethylsilylethoxymethoxy)-1,3-diazepan-2-one |
|---|---|
| PubChem CID | 10651987 |
| Molecular Formula | C37H54N2O5Si2 |
| Molecular Weight | 663.02 g/mol |
| Exact Mass | 662.36 |
| IUPAC Name | (4R,5S,6S,7R)-4,7-dibenzyl-1,3-bis(prop-2-ynyl)-5,6-bis(2-trimethylsilylethoxymethoxy)-1,3-diazepan-2-one |
| SMILES | C#CCN1C(=O)N(CC#C)[C@H](Cc2ccccc2)[C@H](OCOCC[Si](C)(C)C)[C@@H](OCOCC[Si](C)(C)C)[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C37H54N2O5Si2/c1-9-21-38-33(27-31-17-13-11-14-18-31)35(43-29-41-23-25-45(3,4)5)36(44-30-42-24-26-46(6,7)8)34(39(22-10-2)37(38)40)28-32-19-15-12-16-20-32/h1-2,11-20,33-36H,21-30H2,3-8H3/t33-,34-,35+,36+/m1/s1 |
| InChIKey | XFGLAFKXYKPXHC-NWJWHWDBSA-N |
| XLogP | 6.61 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.02 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|