C43H72N4O7Si2 — CID 10771702
(4R,5S,6S,7R)-4,7-dibenzyl-1,3-bis(2-ethylmorpholin-4-yl)-5,6-bis(2-trimethylsilylethoxymethoxy)-1,3-diazepan-2-one (PubChem CID 10771702) has the molecular formula C43H72N4O7Si2 and a molecular weight of 813.24 g/mol. Its IUPAC name is (4R,5S,6S,7R)-4,7-dibenzyl-1,3-bis(2-ethylmorpholin-4-yl)-5,6-bis(2-trimethylsilylethoxymethoxy)-1,3-diazepan-2-one.
| Compound Name | (4R,5S,6S,7R)-4,7-dibenzyl-1,3-bis(2-ethylmorpholin-4-yl)-5,6-bis(2-trimethylsilylethoxymethoxy)-1,3-diazepan-2-one |
|---|---|
| PubChem CID | 10771702 |
| Molecular Formula | C43H72N4O7Si2 |
| Molecular Weight | 813.24 g/mol |
| Exact Mass | 812.49 |
| IUPAC Name | (4R,5S,6S,7R)-4,7-dibenzyl-1,3-bis(2-ethylmorpholin-4-yl)-5,6-bis(2-trimethylsilylethoxymethoxy)-1,3-diazepan-2-one |
| SMILES | CCC1CN(N2C(=O)N(N3CCOC(CC)C3)[C@H](Cc3ccccc3)[C@H](OCOCC[Si](C)(C)C)[C@@H](OCOCC[Si](C)(C)C)[C@H]2Cc2ccccc2)CCO1 |
| InChI | InChI=1S/C43H72N4O7Si2/c1-9-37-31-44(21-23-51-37)46-39(29-35-17-13-11-14-18-35)41(53-33-49-25-27-55(3,4)5)42(54-34-50-26-28-56(6,7)8)40(30-36-19-15-12-16-20-36)47(43(46)48)45-22-24-52-38(10-2)32-45/h11-20,37-42H,9-10,21-34H2,1-8H3/t37?,38?,39-,40-,41+,42+/m1/s1 |
| InChIKey | FSPCQNONFDOVLY-YHGTVNCHSA-N |
| XLogP | 7.39 |
| TPSA | 85.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.24 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|