C40H51N3O5Si — CID 10699737
(5R,6R)-1,5-dibenzyl-2,4-bis[[4-(hydroxymethyl)phenyl]methyl]-6-(2-trimethylsilylethoxymethoxy)-1,2,4-triazepan-3-one (PubChem CID 10699737) has the molecular formula C40H51N3O5Si and a molecular weight of 681.95 g/mol. Its IUPAC name is (5R,6R)-1,5-dibenzyl-2,4-bis[[4-(hydroxymethyl)phenyl]methyl]-6-(2-trimethylsilylethoxymethoxy)-1,2,4-triazepan-3-one.
| Compound Name | (5R,6R)-1,5-dibenzyl-2,4-bis[[4-(hydroxymethyl)phenyl]methyl]-6-(2-trimethylsilylethoxymethoxy)-1,2,4-triazepan-3-one |
|---|---|
| PubChem CID | 10699737 |
| Molecular Formula | C40H51N3O5Si |
| Molecular Weight | 681.95 g/mol |
| Exact Mass | 681.36 |
| IUPAC Name | (5R,6R)-1,5-dibenzyl-2,4-bis[[4-(hydroxymethyl)phenyl]methyl]-6-(2-trimethylsilylethoxymethoxy)-1,2,4-triazepan-3-one |
| SMILES | C[Si](C)(C)CCOCO[C@@H]1CN(Cc2ccccc2)N(Cc2ccc(CO)cc2)C(=O)N(Cc2ccc(CO)cc2)[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C40H51N3O5Si/c1-49(2,3)23-22-47-31-48-39-28-41(25-33-12-8-5-9-13-33)43(27-35-16-20-37(30-45)21-17-35)40(46)42(26-34-14-18-36(29-44)19-15-34)38(39)24-32-10-6-4-7-11-32/h4-21,38-39,44-45H,22-31H2,1-3H3/t38-,39-/m1/s1 |
| InChIKey | JKQOQZYFHJXDBB-LJEWAXOPSA-N |
| XLogP | 6.84 |
| TPSA | 85.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.95 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|