C36H49N3O5Si — CID 10770309
(5R,6R)-1,5-dibenzyl-2-(cyclopropylmethyl)-4-[(4-hydroxy-3-methoxyphenyl)methyl]-6-(2-trimethylsilylethoxymethoxy)-1,2,4-triazepan-3-one (PubChem CID 10770309) has the molecular formula C36H49N3O5Si and a molecular weight of 631.89 g/mol. Its IUPAC name is (5R,6R)-1,5-dibenzyl-2-(cyclopropylmethyl)-4-[(4-hydroxy-3-methoxyphenyl)methyl]-6-(2-trimethylsilylethoxymethoxy)-1,2,4-triazepan-3-one.
| Compound Name | (5R,6R)-1,5-dibenzyl-2-(cyclopropylmethyl)-4-[(4-hydroxy-3-methoxyphenyl)methyl]-6-(2-trimethylsilylethoxymethoxy)-1,2,4-triazepan-3-one |
|---|---|
| PubChem CID | 10770309 |
| Molecular Formula | C36H49N3O5Si |
| Molecular Weight | 631.89 g/mol |
| Exact Mass | 631.34 |
| IUPAC Name | (5R,6R)-1,5-dibenzyl-2-(cyclopropylmethyl)-4-[(4-hydroxy-3-methoxyphenyl)methyl]-6-(2-trimethylsilylethoxymethoxy)-1,2,4-triazepan-3-one |
| SMILES | COc1cc(CN2C(=O)N(CC3CC3)N(Cc3ccccc3)C[C@@H](OCOCC[Si](C)(C)C)[C@H]2Cc2ccccc2)ccc1O |
| InChI | InChI=1S/C36H49N3O5Si/c1-42-34-22-31(17-18-33(34)40)24-38-32(21-28-11-7-5-8-12-28)35(44-27-43-19-20-45(2,3)4)26-37(23-29-13-9-6-10-14-29)39(36(38)41)25-30-15-16-30/h5-14,17-18,22,30,32,35,40H,15-16,19-21,23-27H2,1-4H3/t32-,35-/m1/s1 |
| InChIKey | JOIRXIBRYSGQBJ-FHPVIJFVSA-N |
| XLogP | 6.77 |
| TPSA | 74.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.89 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|