C38H43N6O7P — CID 16729992
3-[[3-[[(4R,5S,6S,7R)-3-[(3-amino-1H-indazol-5-yl)methyl]-4,7-dibenzyl-5,6-dihydroxy-2-oxo-1,3-diazepan-1-yl]methyl]benzoyl]amino]propylphosphonic acid (PubChem CID 16729992) has the molecular formula C38H43N6O7P and a molecular weight of 726.77 g/mol. Its IUPAC name is 3-[[3-[[(4R,5S,6S,7R)-3-[(3-amino-1H-indazol-5-yl)methyl]-4,7-dibenzyl-5,6-dihydroxy-2-oxo-1,3-diazepan-1-yl]methyl]benzoyl]amino]propylphosphonic acid.
| Compound Name | 3-[[3-[[(4R,5S,6S,7R)-3-[(3-amino-1H-indazol-5-yl)methyl]-4,7-dibenzyl-5,6-dihydroxy-2-oxo-1,3-diazepan-1-yl]methyl]benzoyl]amino]propylphosphonic acid |
|---|---|
| PubChem CID | 16729992 |
| Molecular Formula | C38H43N6O7P |
| Molecular Weight | 726.77 g/mol |
| Exact Mass | 726.29 |
| IUPAC Name | 3-[[3-[[(4R,5S,6S,7R)-3-[(3-amino-1H-indazol-5-yl)methyl]-4,7-dibenzyl-5,6-dihydroxy-2-oxo-1,3-diazepan-1-yl]methyl]benzoyl]amino]propylphosphonic acid |
| SMILES | Nc1n[nH]c2ccc(CN3C(=O)N(Cc4cccc(C(=O)NCCCP(=O)(O)O)c4)[C@H](Cc4ccccc4)[C@H](O)[C@@H](O)[C@H]3Cc3ccccc3)cc12 |
| InChI | InChI=1S/C38H43N6O7P/c39-36-30-20-28(15-16-31(30)41-42-36)24-44-33(22-26-11-5-2-6-12-26)35(46)34(45)32(21-25-9-3-1-4-10-25)43(38(44)48)23-27-13-7-14-29(19-27)37(47)40-17-8-18-52(49,50)51/h1-7,9-16,19-20,32-35,45-46H,8,17-18,21-24H2,(H,40,47)(H3,39,41,42)(H2,49,50,51)/t32-,33-,34+,35+/m1/s1 |
| InChIKey | GCIDUVNAFVNHTI-WDKGQIBQSA-N |
| XLogP | 3.82 |
| TPSA | 205.34 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.77 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|