C41H53N5O3 — CID 91239350
(4R,5S,6S,7R)-1-[(3-amino-1H-indazol-5-yl)methyl]-3,4,7-tribenzyl-5,6-dihydroxy-1,3-diazepan-2-one;butane;propane (PubChem CID 91239350) has the molecular formula C41H53N5O3 and a molecular weight of 663.91 g/mol. Its IUPAC name is (4R,5S,6S,7R)-1-[(3-amino-1H-indazol-5-yl)methyl]-3,4,7-tribenzyl-5,6-dihydroxy-1,3-diazepan-2-one;butane;propane.
| Compound Name | (4R,5S,6S,7R)-1-[(3-amino-1H-indazol-5-yl)methyl]-3,4,7-tribenzyl-5,6-dihydroxy-1,3-diazepan-2-one;butane;propane |
|---|---|
| PubChem CID | 91239350 |
| Molecular Formula | C41H53N5O3 |
| Molecular Weight | 663.91 g/mol |
| Exact Mass | 663.41 |
| IUPAC Name | (4R,5S,6S,7R)-1-[(3-amino-1H-indazol-5-yl)methyl]-3,4,7-tribenzyl-5,6-dihydroxy-1,3-diazepan-2-one;butane;propane |
| SMILES | CCC.CCCC.Nc1n[nH]c2ccc(CN3C(=O)N(Cc4ccccc4)[C@H](Cc4ccccc4)[C@H](O)[C@@H](O)[C@H]3Cc3ccccc3)cc12 |
| InChI | InChI=1S/C34H35N5O3.C4H10.C3H8/c35-33-27-18-26(16-17-28(27)36-37-33)22-39-30(20-24-12-6-2-7-13-24)32(41)31(40)29(19-23-10-4-1-5-11-23)38(34(39)42)21-25-14-8-3-9-15-25;1-3-4-2;1-3-2/h1-18,29-32,40-41H,19-22H2,(H3,35,36,37);3-4H2,1-2H3;3H2,1-2H3/t29-,30-,31+,32+;;/m1../s1 |
| InChIKey | XNARHFYGJXWBLU-YSVIXOAZSA-N |
| XLogP | 7.75 |
| TPSA | 118.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.91 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |