C34H36N5O7P — CID 70930672
[4-[[(4R,5S,6S)-3-[(3-amino-1H-indazol-5-yl)methyl]-4-benzyl-5,6-dihydroxy-2-oxo-7-phenyl-1,3-diazepan-1-yl]methyl]phenoxy]methylphosphonic acid (PubChem CID 70930672) has the molecular formula C34H36N5O7P and a molecular weight of 657.66 g/mol. Its IUPAC name is [4-[[(4R,5S,6S)-3-[(3-amino-1H-indazol-5-yl)methyl]-4-benzyl-5,6-dihydroxy-2-oxo-7-phenyl-1,3-diazepan-1-yl]methyl]phenoxy]methylphosphonic acid.
| Compound Name | [4-[[(4R,5S,6S)-3-[(3-amino-1H-indazol-5-yl)methyl]-4-benzyl-5,6-dihydroxy-2-oxo-7-phenyl-1,3-diazepan-1-yl]methyl]phenoxy]methylphosphonic acid |
|---|---|
| PubChem CID | 70930672 |
| Molecular Formula | C34H36N5O7P |
| Molecular Weight | 657.66 g/mol |
| Exact Mass | 657.24 |
| IUPAC Name | [4-[[(4R,5S,6S)-3-[(3-amino-1H-indazol-5-yl)methyl]-4-benzyl-5,6-dihydroxy-2-oxo-7-phenyl-1,3-diazepan-1-yl]methyl]phenoxy]methylphosphonic acid |
| SMILES | Nc1n[nH]c2ccc(CN3C(=O)N(Cc4ccc(OCP(=O)(O)O)cc4)C(c4ccccc4)[C@H](O)[C@@H](O)[C@H]3Cc3ccccc3)cc12 |
| InChI | InChI=1S/C34H36N5O7P/c35-33-27-17-24(13-16-28(27)36-37-33)20-38-29(18-22-7-3-1-4-8-22)31(40)32(41)30(25-9-5-2-6-10-25)39(34(38)42)19-23-11-14-26(15-12-23)46-21-47(43,44)45/h1-17,29-32,40-41H,18-21H2,(H3,35,36,37)(H2,43,44,45)/t29-,30?,31+,32+/m1/s1 |
| InChIKey | DPTWAWSJPQHEKR-JZJNTNSZSA-N |
| XLogP | 4.17 |
| TPSA | 185.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.66 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|