C42H50N5O9P — CID 59132314
ethyl (2S)-2-[3-[(4R,5S,6S,7R)-3-[(3-amino-1H-indazol-5-yl)methyl]-4,7-dibenzyl-5,6-dihydroxy-2-oxo-1,3-diazepan-1-yl]propoxymethyl-phenoxyphosphoryl]oxypropanoate (PubChem CID 59132314) has the molecular formula C42H50N5O9P and a molecular weight of 799.86 g/mol. Its IUPAC name is ethyl (2S)-2-[3-[(4R,5S,6S,7R)-3-[(3-amino-1H-indazol-5-yl)methyl]-4,7-dibenzyl-5,6-dihydroxy-2-oxo-1,3-diazepan-1-yl]propoxymethyl-phenoxyphosphoryl]oxypropanoate.
| Compound Name | ethyl (2S)-2-[3-[(4R,5S,6S,7R)-3-[(3-amino-1H-indazol-5-yl)methyl]-4,7-dibenzyl-5,6-dihydroxy-2-oxo-1,3-diazepan-1-yl]propoxymethyl-phenoxyphosphoryl]oxypropanoate |
|---|---|
| PubChem CID | 59132314 |
| Molecular Formula | C42H50N5O9P |
| Molecular Weight | 799.86 g/mol |
| Exact Mass | 799.33 |
| IUPAC Name | ethyl (2S)-2-[3-[(4R,5S,6S,7R)-3-[(3-amino-1H-indazol-5-yl)methyl]-4,7-dibenzyl-5,6-dihydroxy-2-oxo-1,3-diazepan-1-yl]propoxymethyl-phenoxyphosphoryl]oxypropanoate |
| SMILES | CCOC(=O)[C@H](C)OP(=O)(COCCCN1C(=O)N(Cc2ccc3[nH]nc(N)c3c2)[C@H](Cc2ccccc2)[C@H](O)[C@@H](O)[C@H]1Cc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C42H50N5O9P/c1-3-54-41(50)29(2)55-57(52,56-33-18-11-6-12-19-33)28-53-23-13-22-46-36(25-30-14-7-4-8-15-30)38(48)39(49)37(26-31-16-9-5-10-17-31)47(42(46)51)27-32-20-21-35-34(24-32)40(43)45-44-35/h4-12,14-21,24,29,36-39,48-49H,3,13,22-23,25-28H2,1-2H3,(H3,43,44,45)/t29-,36+,37+,38-,39-,57?/m0/s1 |
| InChIKey | WVEFAAOGUWGPGI-QGMHJLLYSA-N |
| XLogP | 5.93 |
| TPSA | 189.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.86 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|