C36H38N4O5 — CID 102317126
3-[[(4R,5S,6S,7R)-4,7-dibenzyl-5,6-dihydroxy-3-[3-(methylcarbamoyl)phenyl]-2-oxo-1,3-diazepan-1-yl]methyl]-N-methylbenzamide (PubChem CID 102317126) has the molecular formula C36H38N4O5 and a molecular weight of 606.72 g/mol. Its IUPAC name is 3-[[(4R,5S,6S,7R)-4,7-dibenzyl-5,6-dihydroxy-3-[3-(methylcarbamoyl)phenyl]-2-oxo-1,3-diazepan-1-yl]methyl]-N-methylbenzamide.
| Compound Name | 3-[[(4R,5S,6S,7R)-4,7-dibenzyl-5,6-dihydroxy-3-[3-(methylcarbamoyl)phenyl]-2-oxo-1,3-diazepan-1-yl]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 102317126 |
| Molecular Formula | C36H38N4O5 |
| Molecular Weight | 606.72 g/mol |
| Exact Mass | 606.28 |
| IUPAC Name | 3-[[(4R,5S,6S,7R)-4,7-dibenzyl-5,6-dihydroxy-3-[3-(methylcarbamoyl)phenyl]-2-oxo-1,3-diazepan-1-yl]methyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc(CN2C(=O)N(c3cccc(C(=O)NC)c3)[C@H](Cc3ccccc3)[C@H](O)[C@@H](O)[C@H]2Cc2ccccc2)c1 |
| InChI | InChI=1S/C36H38N4O5/c1-37-34(43)27-16-9-15-26(19-27)23-39-30(20-24-11-5-3-6-12-24)32(41)33(42)31(21-25-13-7-4-8-14-25)40(36(39)45)29-18-10-17-28(22-29)35(44)38-2/h3-19,22,30-33,41-42H,20-21,23H2,1-2H3,(H,37,43)(H,38,44)/t30-,31-,32+,33+/m1/s1 |
| InChIKey | KDYXSYARGHCYPP-FYZVQMPESA-N |
| XLogP | 3.79 |
| TPSA | 122.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.72 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |