C18H30N3O6P — CID 142774476
ethyl 2-[[2-aminoethyl-[(1-ethoxy-1-oxopropan-2-yl)-phenoxyamino]phosphoryl]amino]propanoate (PubChem CID 142774476) has the molecular formula C18H30N3O6P and a molecular weight of 415.43 g/mol. Its IUPAC name is ethyl 2-[[2-aminoethyl-[(1-ethoxy-1-oxopropan-2-yl)-phenoxyamino]phosphoryl]amino]propanoate.
| Compound Name | ethyl 2-[[2-aminoethyl-[(1-ethoxy-1-oxopropan-2-yl)-phenoxyamino]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 142774476 |
| Molecular Formula | C18H30N3O6P |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | ethyl 2-[[2-aminoethyl-[(1-ethoxy-1-oxopropan-2-yl)-phenoxyamino]phosphoryl]amino]propanoate |
| SMILES | CCOC(=O)C(C)NP(=O)(CCN)N(Oc1ccccc1)C(C)C(=O)OCC |
| InChI | InChI=1S/C18H30N3O6P/c1-5-25-17(22)14(3)20-28(24,13-12-19)21(15(4)18(23)26-6-2)27-16-10-8-7-9-11-16/h7-11,14-15H,5-6,12-13,19H2,1-4H3,(H,20,24) |
| InChIKey | TZAVJUQNVAXEJJ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 120.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|