C24H25ClNO4P — CID 87147629
cyclohexyl 2-[[chloro(naphthalen-1-yloxy)phosphoryl]amino]-2-phenylacetate (PubChem CID 87147629) has the molecular formula C24H25ClNO4P and a molecular weight of 457.89 g/mol. Its IUPAC name is cyclohexyl 2-[[chloro(naphthalen-1-yloxy)phosphoryl]amino]-2-phenylacetate.
| Compound Name | cyclohexyl 2-[[chloro(naphthalen-1-yloxy)phosphoryl]amino]-2-phenylacetate |
|---|---|
| PubChem CID | 87147629 |
| Molecular Formula | C24H25ClNO4P |
| Molecular Weight | 457.89 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | cyclohexyl 2-[[chloro(naphthalen-1-yloxy)phosphoryl]amino]-2-phenylacetate |
| SMILES | O=C(OC1CCCCC1)C(NP(=O)(Cl)Oc1cccc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C24H25ClNO4P/c25-31(28,30-22-17-9-13-18-10-7-8-16-21(18)22)26-23(19-11-3-1-4-12-19)24(27)29-20-14-5-2-6-15-20/h1,3-4,7-13,16-17,20,23H,2,5-6,14-15H2,(H,26,28) |
| InChIKey | YOPROFPESZHHSZ-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.89 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|