C23H24BrClNO4P — CID 87147881
[(1S)-1-(2-bromophenyl)ethyl] (2S)-2-[[chloro(naphthalen-1-yloxy)phosphoryl]amino]-3-methylbutanoate (PubChem CID 87147881) has the molecular formula C23H24BrClNO4P and a molecular weight of 524.78 g/mol. Its IUPAC name is [(1S)-1-(2-bromophenyl)ethyl] (2S)-2-[[chloro(naphthalen-1-yloxy)phosphoryl]amino]-3-methylbutanoate.
| Compound Name | [(1S)-1-(2-bromophenyl)ethyl] (2S)-2-[[chloro(naphthalen-1-yloxy)phosphoryl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 87147881 |
| Molecular Formula | C23H24BrClNO4P |
| Molecular Weight | 524.78 g/mol |
| Exact Mass | 523.03 |
| IUPAC Name | [(1S)-1-(2-bromophenyl)ethyl] (2S)-2-[[chloro(naphthalen-1-yloxy)phosphoryl]amino]-3-methylbutanoate |
| SMILES | CC(C)[C@H](NP(=O)(Cl)Oc1cccc2ccccc12)C(=O)O[C@@H](C)c1ccccc1Br |
| InChI | InChI=1S/C23H24BrClNO4P/c1-15(2)22(23(27)29-16(3)18-11-6-7-13-20(18)24)26-31(25,28)30-21-14-8-10-17-9-4-5-12-19(17)21/h4-16,22H,1-3H3,(H,26,28)/t16-,22-,31?/m0/s1 |
| InChIKey | ZPYNDVWEJJUELC-MEQGAGHDSA-N |
| XLogP | 7.25 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.78 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|