C19H23ClNO6P — CID 87147748
2-[[chloro-[6-[(2S)-1-methoxy-1-oxopropan-2-yl]naphthalen-2-yl]oxyphosphoryl]amino]-3-methylbutanoic acid (PubChem CID 87147748) has the molecular formula C19H23ClNO6P and a molecular weight of 427.82 g/mol. Its IUPAC name is 2-[[chloro-[6-[(2S)-1-methoxy-1-oxopropan-2-yl]naphthalen-2-yl]oxyphosphoryl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[chloro-[6-[(2S)-1-methoxy-1-oxopropan-2-yl]naphthalen-2-yl]oxyphosphoryl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 87147748 |
| Molecular Formula | C19H23ClNO6P |
| Molecular Weight | 427.82 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 2-[[chloro-[6-[(2S)-1-methoxy-1-oxopropan-2-yl]naphthalen-2-yl]oxyphosphoryl]amino]-3-methylbutanoic acid |
| SMILES | COC(=O)[C@@H](C)c1ccc2cc(OP(=O)(Cl)NC(C(=O)O)C(C)C)ccc2c1 |
| InChI | InChI=1S/C19H23ClNO6P/c1-11(2)17(18(22)23)21-28(20,25)27-16-8-7-14-9-13(5-6-15(14)10-16)12(3)19(24)26-4/h5-12,17H,1-4H3,(H,21,25)(H,22,23)/t12-,17?,28?/m0/s1 |
| InChIKey | QHJICRVPIJOZRN-FVVGSNHNSA-N |
| XLogP | 4.54 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.82 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|