C27H39BrNO6P — CID 91335783
butyl 2-bromo-3-phenylpropanoate;butyl 2-[[methyl(phenoxy)phosphoryl]amino]propanoate (PubChem CID 91335783) has the molecular formula C27H39BrNO6P and a molecular weight of 584.49 g/mol. Its IUPAC name is butyl 2-bromo-3-phenylpropanoate;butyl 2-[[methyl(phenoxy)phosphoryl]amino]propanoate.
| Compound Name | butyl 2-bromo-3-phenylpropanoate;butyl 2-[[methyl(phenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 91335783 |
| Molecular Formula | C27H39BrNO6P |
| Molecular Weight | 584.49 g/mol |
| Exact Mass | 583.17 |
| IUPAC Name | butyl 2-bromo-3-phenylpropanoate;butyl 2-[[methyl(phenoxy)phosphoryl]amino]propanoate |
| SMILES | CCCCOC(=O)C(Br)Cc1ccccc1.CCCCOC(=O)C(C)NP(C)(=O)Oc1ccccc1 |
| InChI | InChI=1S/C14H22NO4P.C13H17BrO2/c1-4-5-11-18-14(16)12(2)15-20(3,17)19-13-9-7-6-8-10-13;1-2-3-9-16-13(15)12(14)10-11-7-5-4-6-8-11/h6-10,12H,4-5,11H2,1-3H3,(H,15,17);4-8,12H,2-3,9-10H2,1H3 |
| InChIKey | DIGYQOQMDBWVCI-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.49 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|