C25H35FN3O10P — CID 146905044
cyclohexyl 2-[[[(2S,3S,4R,5R)-2-fluoro-3,4-dihydroxy-5-(2-hydroxy-6-oxo-1,2-dihydropyrimidin-3-yl)-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 146905044) has the molecular formula C25H35FN3O10P and a molecular weight of 587.54 g/mol. Its IUPAC name is cyclohexyl 2-[[[(2S,3S,4R,5R)-2-fluoro-3,4-dihydroxy-5-(2-hydroxy-6-oxo-1,2-dihydropyrimidin-3-yl)-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | cyclohexyl 2-[[[(2S,3S,4R,5R)-2-fluoro-3,4-dihydroxy-5-(2-hydroxy-6-oxo-1,2-dihydropyrimidin-3-yl)-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 146905044 |
| Molecular Formula | C25H35FN3O10P |
| Molecular Weight | 587.54 g/mol |
| Exact Mass | 587.20 |
| IUPAC Name | cyclohexyl 2-[[[(2S,3S,4R,5R)-2-fluoro-3,4-dihydroxy-5-(2-hydroxy-6-oxo-1,2-dihydropyrimidin-3-yl)-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(NP(=O)(OC[C@@]1(F)O[C@@H](N2C=CC(=O)NC2O)[C@](C)(O)[C@@H]1O)Oc1ccccc1)C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C25H35FN3O10P/c1-16(20(31)37-17-9-5-3-6-10-17)28-40(35,39-18-11-7-4-8-12-18)36-15-25(26)21(32)24(2,34)22(38-25)29-14-13-19(30)27-23(29)33/h4,7-8,11-14,16-17,21-23,32-34H,3,5-6,9-10,15H2,1-2H3,(H,27,30)(H,28,35)/t16?,21-,22+,23?,24+,25+,40?/m0/s1 |
| InChIKey | AAFAKAPWUBIBTH-BGWUMNPPSA-N |
| XLogP | 1.40 |
| TPSA | 176.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.54 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|