C26H34F2N3O8P — CID 90251388
cyclohexyl 2-[[[(2S,3S,4R,5R)-2,4-difluoro-3-hydroxy-4-methyl-5-(2-methylidene-4-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 90251388) has the molecular formula C26H34F2N3O8P and a molecular weight of 585.54 g/mol. Its IUPAC name is cyclohexyl 2-[[[(2S,3S,4R,5R)-2,4-difluoro-3-hydroxy-4-methyl-5-(2-methylidene-4-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | cyclohexyl 2-[[[(2S,3S,4R,5R)-2,4-difluoro-3-hydroxy-4-methyl-5-(2-methylidene-4-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 90251388 |
| Molecular Formula | C26H34F2N3O8P |
| Molecular Weight | 585.54 g/mol |
| Exact Mass | 585.21 |
| IUPAC Name | cyclohexyl 2-[[[(2S,3S,4R,5R)-2,4-difluoro-3-hydroxy-4-methyl-5-(2-methylidene-4-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C=C1NC(=O)C=CN1[C@@H]1O[C@](F)(COP(=O)(NC(C)C(=O)OC2CCCCC2)Oc2ccccc2)[C@@H](O)[C@@]1(C)F |
| InChI | InChI=1S/C26H34F2N3O8P/c1-17(22(33)37-19-10-6-4-7-11-19)30-40(35,39-20-12-8-5-9-13-20)36-16-26(28)23(34)25(3,27)24(38-26)31-15-14-21(32)29-18(31)2/h5,8-9,12-15,17,19,23-24,34H,2,4,6-7,10-11,16H2,1,3H3,(H,29,32)(H,30,35)/t17?,23-,24+,25+,26+,40?/m0/s1 |
| InChIKey | UCAHSPHDXPZYQI-YUHKONANSA-N |
| XLogP | 3.57 |
| TPSA | 135.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.54 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|