C29H40F2N5O8P — CID 118672976
cyclohexyl 2-[[[(2S,3S,4R,5R)-5-(6-ethoxy-2-methyl-4,5-dihydropurin-9-yl)-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 118672976) has the molecular formula C29H40F2N5O8P and a molecular weight of 655.64 g/mol. Its IUPAC name is cyclohexyl 2-[[[(2S,3S,4R,5R)-5-(6-ethoxy-2-methyl-4,5-dihydropurin-9-yl)-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | cyclohexyl 2-[[[(2S,3S,4R,5R)-5-(6-ethoxy-2-methyl-4,5-dihydropurin-9-yl)-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 118672976 |
| Molecular Formula | C29H40F2N5O8P |
| Molecular Weight | 655.64 g/mol |
| Exact Mass | 655.26 |
| IUPAC Name | cyclohexyl 2-[[[(2S,3S,4R,5R)-5-(6-ethoxy-2-methyl-4,5-dihydropurin-9-yl)-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCOC1=NC(C)=NC2C1N=CN2[C@@H]1O[C@](F)(COP(=O)(NC(C)C(=O)OC2CCCCC2)Oc2ccccc2)[C@@H](O)[C@@]1(C)F |
| InChI | InChI=1S/C29H40F2N5O8P/c1-5-40-24-22-23(33-19(3)34-24)36(17-32-22)27-28(4,30)26(38)29(31,43-27)16-41-45(39,44-21-14-10-7-11-15-21)35-18(2)25(37)42-20-12-8-6-9-13-20/h7,10-11,14-15,17-18,20,22-23,26-27,38H,5-6,8-9,12-13,16H2,1-4H3,(H,35,39)/t18?,22?,23?,26-,27+,28+,29+,45?/m0/s1 |
| InChIKey | KUBRTWCRRWABPF-RUWOOYHKSA-N |
| XLogP | 4.06 |
| TPSA | 152.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.64 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|