C25H31FN3O10P — CID 129150078
cyclohexyl 2-[[[(1S,3R,4R,5S)-3-(2,4-dioxopyrimidin-1-yl)-1-fluoro-4,5-dihydroxy-4-methyl-2-oxabicyclo[3.1.0]hexan-6-yl]oxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 129150078) has the molecular formula C25H31FN3O10P and a molecular weight of 583.51 g/mol. Its IUPAC name is cyclohexyl 2-[[[(1S,3R,4R,5S)-3-(2,4-dioxopyrimidin-1-yl)-1-fluoro-4,5-dihydroxy-4-methyl-2-oxabicyclo[3.1.0]hexan-6-yl]oxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | cyclohexyl 2-[[[(1S,3R,4R,5S)-3-(2,4-dioxopyrimidin-1-yl)-1-fluoro-4,5-dihydroxy-4-methyl-2-oxabicyclo[3.1.0]hexan-6-yl]oxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 129150078 |
| Molecular Formula | C25H31FN3O10P |
| Molecular Weight | 583.51 g/mol |
| Exact Mass | 583.17 |
| IUPAC Name | cyclohexyl 2-[[[(1S,3R,4R,5S)-3-(2,4-dioxopyrimidin-1-yl)-1-fluoro-4,5-dihydroxy-4-methyl-2-oxabicyclo[3.1.0]hexan-6-yl]oxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(N[P@@](=O)(Oc1ccccc1)OC1[C@]2(O)[C@@](C)(O)[C@H](n3ccc(=O)[nH]c3=O)O[C@]12F)C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C25H31FN3O10P/c1-15(19(31)36-16-9-5-3-6-10-16)28-40(35,38-17-11-7-4-8-12-17)39-20-24(34)23(2,33)21(37-25(20,24)26)29-14-13-18(30)27-22(29)32/h4,7-8,11-16,20-21,33-34H,3,5-6,9-10H2,1-2H3,(H,28,35)(H,27,30,32)/t15?,20?,21-,23+,24+,25-,40-/m1/s1 |
| InChIKey | DXGDYJYMVAWVBY-IFLBOFBWSA-N |
| XLogP | 1.65 |
| TPSA | 178.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.51 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|