C22H27FN3O10P — CID 126556472
propan-2-yl (2S)-2-[[[(1S,3R,4R,5S)-3-(2,4-dioxopyrimidin-1-yl)-1-fluoro-4,5-dihydroxy-4-methyl-2-oxabicyclo[3.1.0]hexan-6-yl]oxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 126556472) has the molecular formula C22H27FN3O10P and a molecular weight of 543.44 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(1S,3R,4R,5S)-3-(2,4-dioxopyrimidin-1-yl)-1-fluoro-4,5-dihydroxy-4-methyl-2-oxabicyclo[3.1.0]hexan-6-yl]oxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(1S,3R,4R,5S)-3-(2,4-dioxopyrimidin-1-yl)-1-fluoro-4,5-dihydroxy-4-methyl-2-oxabicyclo[3.1.0]hexan-6-yl]oxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 126556472 |
| Molecular Formula | C22H27FN3O10P |
| Molecular Weight | 543.44 g/mol |
| Exact Mass | 543.14 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(1S,3R,4R,5S)-3-(2,4-dioxopyrimidin-1-yl)-1-fluoro-4,5-dihydroxy-4-methyl-2-oxabicyclo[3.1.0]hexan-6-yl]oxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)NP(=O)(Oc1ccccc1)OC1[C@]2(O)[C@@](C)(O)[C@H](n3ccc(=O)[nH]c3=O)O[C@]12F |
| InChI | InChI=1S/C22H27FN3O10P/c1-12(2)33-16(28)13(3)25-37(32,35-14-8-6-5-7-9-14)36-17-21(31)20(4,30)18(34-22(17,21)23)26-11-10-15(27)24-19(26)29/h5-13,17-18,30-31H,1-4H3,(H,25,32)(H,24,27,29)/t13-,17?,18+,20-,21-,22+,37?/m0/s1 |
| InChIKey | HRSRCYPFFVITFU-ZCXCFZDZSA-N |
| XLogP | 0.73 |
| TPSA | 178.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.44 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|