C23H25FN3O9P — CID 139513587
propan-2-yl 2-[[[(1R,3R,4R,5R)-3-(2,4-dioxopyrimidin-1-yl)-1-ethynyl-4-fluoro-5-hydroxy-2-oxabicyclo[3.1.0]hexan-6-yl]oxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 139513587) has the molecular formula C23H25FN3O9P and a molecular weight of 537.44 g/mol. Its IUPAC name is propan-2-yl 2-[[[(1R,3R,4R,5R)-3-(2,4-dioxopyrimidin-1-yl)-1-ethynyl-4-fluoro-5-hydroxy-2-oxabicyclo[3.1.0]hexan-6-yl]oxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[(1R,3R,4R,5R)-3-(2,4-dioxopyrimidin-1-yl)-1-ethynyl-4-fluoro-5-hydroxy-2-oxabicyclo[3.1.0]hexan-6-yl]oxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 139513587 |
| Molecular Formula | C23H25FN3O9P |
| Molecular Weight | 537.44 g/mol |
| Exact Mass | 537.13 |
| IUPAC Name | propan-2-yl 2-[[[(1R,3R,4R,5R)-3-(2,4-dioxopyrimidin-1-yl)-1-ethynyl-4-fluoro-5-hydroxy-2-oxabicyclo[3.1.0]hexan-6-yl]oxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C#C[C@]12O[C@@H](n3ccc(=O)[nH]c3=O)[C@H](F)[C@@]1(O)C2OP(=O)(NC(C)C(=O)OC(C)C)Oc1ccccc1 |
| InChI | InChI=1S/C23H25FN3O9P/c1-5-22-20(23(22,31)17(24)18(34-22)27-12-11-16(28)25-21(27)30)36-37(32,35-15-9-7-6-8-10-15)26-14(4)19(29)33-13(2)3/h1,6-14,17-18,20,31H,2-4H3,(H,26,32)(H,25,28,30)/t14?,17-,18+,20?,22+,23+,37?/m0/s1 |
| InChIKey | ZUBQUGVSRVBUNK-WLGUNDNJSA-N |
| XLogP | 1.02 |
| TPSA | 158.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.44 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|