C23H28N3O9PS — CID 166877647
propan-2-yl (2S)-2-[[[(1R,3R,4R,5S)-3-(2,4-dioxopyrimidin-1-yl)-5-hydroxyspiro[2-oxabicyclo[3.1.0]hexane-4,2'-thietane]-6-yl]oxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 166877647) has the molecular formula C23H28N3O9PS and a molecular weight of 553.53 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(1R,3R,4R,5S)-3-(2,4-dioxopyrimidin-1-yl)-5-hydroxyspiro[2-oxabicyclo[3.1.0]hexane-4,2'-thietane]-6-yl]oxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(1R,3R,4R,5S)-3-(2,4-dioxopyrimidin-1-yl)-5-hydroxyspiro[2-oxabicyclo[3.1.0]hexane-4,2'-thietane]-6-yl]oxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 166877647 |
| Molecular Formula | C23H28N3O9PS |
| Molecular Weight | 553.53 g/mol |
| Exact Mass | 553.13 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(1R,3R,4R,5S)-3-(2,4-dioxopyrimidin-1-yl)-5-hydroxyspiro[2-oxabicyclo[3.1.0]hexane-4,2'-thietane]-6-yl]oxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)NP(=O)(Oc1ccccc1)OC1[C@H]2O[C@@H](n3ccc(=O)[nH]c3=O)[C@@]3(CCS3)[C@@]12O |
| InChI | InChI=1S/C23H28N3O9PS/c1-13(2)32-19(28)14(3)25-36(31,34-15-7-5-4-6-8-15)35-18-17-23(18,30)22(10-12-37-22)20(33-17)26-11-9-16(27)24-21(26)29/h4-9,11,13-14,17-18,20,30H,10,12H2,1-3H3,(H,25,31)(H,24,27,29)/t14-,17+,18?,20+,22-,23-,36?/m0/s1 |
| InChIKey | RLNBEJNRNLOWSA-OEIUHRDNSA-N |
| XLogP | 1.56 |
| TPSA | 158.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.53 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|