C28H35F2N6O8P — CID 144985532
cyclohexyl 2-[[[(1S,3R,4R,5R)-3-(2-amino-6-ethoxypurin-9-yl)-1,4-difluoro-5-hydroxy-4-methyl-2-oxabicyclo[3.1.0]hexan-6-yl]oxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 144985532) has the molecular formula C28H35F2N6O8P and a molecular weight of 652.59 g/mol. Its IUPAC name is cyclohexyl 2-[[[(1S,3R,4R,5R)-3-(2-amino-6-ethoxypurin-9-yl)-1,4-difluoro-5-hydroxy-4-methyl-2-oxabicyclo[3.1.0]hexan-6-yl]oxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | cyclohexyl 2-[[[(1S,3R,4R,5R)-3-(2-amino-6-ethoxypurin-9-yl)-1,4-difluoro-5-hydroxy-4-methyl-2-oxabicyclo[3.1.0]hexan-6-yl]oxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 144985532 |
| Molecular Formula | C28H35F2N6O8P |
| Molecular Weight | 652.59 g/mol |
| Exact Mass | 652.22 |
| IUPAC Name | cyclohexyl 2-[[[(1S,3R,4R,5R)-3-(2-amino-6-ethoxypurin-9-yl)-1,4-difluoro-5-hydroxy-4-methyl-2-oxabicyclo[3.1.0]hexan-6-yl]oxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCOc1nc(N)nc2c1ncn2[C@@H]1O[C@]2(F)C(OP(=O)(NC(C)C(=O)OC3CCCCC3)Oc3ccccc3)[C@@]2(O)[C@@]1(C)F |
| InChI | InChI=1S/C28H35F2N6O8P/c1-4-40-21-19-20(33-25(31)34-21)36(15-32-19)24-26(3,29)27(38)23(28(27,30)42-24)44-45(39,43-18-13-9-6-10-14-18)35-16(2)22(37)41-17-11-7-5-8-12-17/h6,9-10,13-17,23-24,38H,4-5,7-8,11-12H2,1-3H3,(H,35,39)(H2,31,33,34)/t16?,23?,24-,26+,27-,28-,45?/m1/s1 |
| InChIKey | RPFMUIIKPJEBAW-NDZOQCDZSA-N |
| XLogP | 3.90 |
| TPSA | 182.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.59 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|