C22H33F2N6O8P — CID 118672994
cyclohexyl (2S)-2-[[[(2S,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]peroxy-methylphosphoryl]amino]propanoate (PubChem CID 118672994) has the molecular formula C22H33F2N6O8P and a molecular weight of 578.51 g/mol. Its IUPAC name is cyclohexyl (2S)-2-[[[(2S,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]peroxy-methylphosphoryl]amino]propanoate.
| Compound Name | cyclohexyl (2S)-2-[[[(2S,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]peroxy-methylphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 118672994 |
| Molecular Formula | C22H33F2N6O8P |
| Molecular Weight | 578.51 g/mol |
| Exact Mass | 578.21 |
| IUPAC Name | cyclohexyl (2S)-2-[[[(2S,3S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-2,4-difluoro-3-hydroxy-4-methyloxolan-2-yl]peroxy-methylphosphoryl]amino]propanoate |
| SMILES | CCOc1nc(N)nc2c1ncn2[C@@H]1O[C@](F)(OO[P@](C)(=O)N[C@@H](C)C(=O)OC2CCCCC2)[C@@H](O)[C@@]1(C)F |
| InChI | InChI=1S/C22H33F2N6O8P/c1-5-34-16-14-15(27-20(25)28-16)30(11-26-14)19-21(3,23)18(32)22(24,36-19)37-38-39(4,33)29-12(2)17(31)35-13-9-7-6-8-10-13/h11-13,18-19,32H,5-10H2,1-4H3,(H,29,33)(H2,25,27,28)/t12-,18-,19+,21+,22-,39-/m0/s1 |
| InChIKey | ACWLBKXDDOQECE-WEBRZPCZSA-N |
| XLogP | 2.67 |
| TPSA | 182.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.51 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|