C10H9F3N2O5 — CID 129150110
1-[(1R,3R,5R)-4,4-difluoro-1-(fluoromethyl)-5,6-dihydroxy-2-oxabicyclo[3.1.0]hexan-3-yl]pyrimidine-2,4-dione (PubChem CID 129150110) has the molecular formula C10H9F3N2O5 and a molecular weight of 294.19 g/mol. Its IUPAC name is 1-[(1R,3R,5R)-4,4-difluoro-1-(fluoromethyl)-5,6-dihydroxy-2-oxabicyclo[3.1.0]hexan-3-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(1R,3R,5R)-4,4-difluoro-1-(fluoromethyl)-5,6-dihydroxy-2-oxabicyclo[3.1.0]hexan-3-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 129150110 |
| Molecular Formula | C10H9F3N2O5 |
| Molecular Weight | 294.19 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 1-[(1R,3R,5R)-4,4-difluoro-1-(fluoromethyl)-5,6-dihydroxy-2-oxabicyclo[3.1.0]hexan-3-yl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn([C@@H]2O[C@]3(CF)C(O)[C@]3(O)C2(F)F)c(=O)[nH]1 |
| InChI | InChI=1S/C10H9F3N2O5/c11-3-8-5(17)9(8,19)10(12,13)6(20-8)15-2-1-4(16)14-7(15)18/h1-2,5-6,17,19H,3H2,(H,14,16,18)/t5?,6-,8-,9-/m1/s1 |
| InChIKey | LUGXNIBBFHKRIA-IYDUGKLZSA-N |
| XLogP | -1.49 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.19 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |