C13H17FN2O6 — CID 175678014
1-[(2R,3R,4S,5R)-5-(fluoromethyl)-3,4-dihydroxy-5-(hydroxymethyl)-3-prop-2-enyloxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 175678014) has the molecular formula C13H17FN2O6 and a molecular weight of 316.29 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-5-(fluoromethyl)-3,4-dihydroxy-5-(hydroxymethyl)-3-prop-2-enyloxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5R)-5-(fluoromethyl)-3,4-dihydroxy-5-(hydroxymethyl)-3-prop-2-enyloxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 175678014 |
| Molecular Formula | C13H17FN2O6 |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-5-(fluoromethyl)-3,4-dihydroxy-5-(hydroxymethyl)-3-prop-2-enyloxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | C=CC[C@@]1(O)[C@H](O)[C@](CO)(CF)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C13H17FN2O6/c1-2-4-13(21)9(19)12(6-14,7-17)22-10(13)16-5-3-8(18)15-11(16)20/h2-3,5,9-10,17,19,21H,1,4,6-7H2,(H,15,18,20)/t9-,10-,12-,13-/m1/s1 |
| InChIKey | KQDFSPCYDMKBKN-FPQZTECRSA-N |
| XLogP | -1.57 |
| TPSA | 124.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|