C12H13FN2O6 — CID 129152338
1-[(1S,3R,5R,6R)-3-(fluoromethyl)-2-hydroxy-6-methyl-4,7,9-trioxatricyclo[4.3.0.01,3]nonan-5-yl]pyrimidine-2,4-dione (PubChem CID 129152338) has the molecular formula C12H13FN2O6 and a molecular weight of 300.24 g/mol. Its IUPAC name is 1-[(1S,3R,5R,6R)-3-(fluoromethyl)-2-hydroxy-6-methyl-4,7,9-trioxatricyclo[4.3.0.01,3]nonan-5-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(1S,3R,5R,6R)-3-(fluoromethyl)-2-hydroxy-6-methyl-4,7,9-trioxatricyclo[4.3.0.01,3]nonan-5-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 129152338 |
| Molecular Formula | C12H13FN2O6 |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 1-[(1S,3R,5R,6R)-3-(fluoromethyl)-2-hydroxy-6-methyl-4,7,9-trioxatricyclo[4.3.0.01,3]nonan-5-yl]pyrimidine-2,4-dione |
| SMILES | C[C@@]12OCO[C@@]13C(O)[C@@]3(CF)O[C@H]2n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C12H13FN2O6/c1-10-8(15-3-2-6(16)14-9(15)18)21-11(4-13)7(17)12(10,11)20-5-19-10/h2-3,7-8,17H,4-5H2,1H3,(H,14,16,18)/t7?,8-,10+,11-,12+/m1/s1 |
| InChIKey | YZAXGBIVBNOYFY-XZVLRXBCSA-N |
| XLogP | -1.35 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |