C12H9FN2O6 — CID 123843202
1-(6-ethynyl-3-fluoro-2-hydroxy-4,7,9-trioxatricyclo[4.3.0.01,3]nonan-5-yl)pyrimidine-2,4-dione (PubChem CID 123843202) has the molecular formula C12H9FN2O6 and a molecular weight of 296.21 g/mol. Its IUPAC name is 1-(6-ethynyl-3-fluoro-2-hydroxy-4,7,9-trioxatricyclo[4.3.0.01,3]nonan-5-yl)pyrimidine-2,4-dione.
| Compound Name | 1-(6-ethynyl-3-fluoro-2-hydroxy-4,7,9-trioxatricyclo[4.3.0.01,3]nonan-5-yl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 123843202 |
| Molecular Formula | C12H9FN2O6 |
| Molecular Weight | 296.21 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 1-(6-ethynyl-3-fluoro-2-hydroxy-4,7,9-trioxatricyclo[4.3.0.01,3]nonan-5-yl)pyrimidine-2,4-dione |
| SMILES | C#CC12OCOC13C(O)C3(F)OC2n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C12H9FN2O6/c1-2-10-8(15-4-3-6(16)14-9(15)18)21-12(13)7(17)11(10,12)20-5-19-10/h1,3-4,7-8,17H,5H2,(H,14,16,18) |
| InChIKey | IZAWWOQREYOSMX-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.21 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|