C14H20N2O4 — CID 144654134
ethane;1-(3-ethynyl-5-methylideneoxolan-2-yl)pyrimidine-2,4-dione;methanol (PubChem CID 144654134) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is ethane;1-(3-ethynyl-5-methylideneoxolan-2-yl)pyrimidine-2,4-dione;methanol.
| Compound Name | ethane;1-(3-ethynyl-5-methylideneoxolan-2-yl)pyrimidine-2,4-dione;methanol |
|---|---|
| PubChem CID | 144654134 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | ethane;1-(3-ethynyl-5-methylideneoxolan-2-yl)pyrimidine-2,4-dione;methanol |
| SMILES | C#CC1CC(=C)OC1n1ccc(=O)[nH]c1=O.CC.CO |
| InChI | InChI=1S/C11H10N2O3.C2H6.CH4O/c1-3-8-6-7(2)16-10(8)13-5-4-9(14)12-11(13)15;2*1-2/h1,4-5,8,10H,2,6H2,(H,12,14,15);1-2H3;2H,1H3 |
| InChIKey | KIPQVEBBMVEUDI-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|