C12H10N2O3 — CID 15216841
1-[(2R,4R,5S)-4,5-diethynyloxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 15216841) has the molecular formula C12H10N2O3 and a molecular weight of 230.22 g/mol. Its IUPAC name is 1-[(2R,4R,5S)-4,5-diethynyloxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4R,5S)-4,5-diethynyloxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 15216841 |
| Molecular Formula | C12H10N2O3 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 1-[(2R,4R,5S)-4,5-diethynyloxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | C#C[C@H]1C[C@H](n2ccc(=O)[nH]c2=O)O[C@@H]1C#C |
| InChI | InChI=1S/C12H10N2O3/c1-3-8-7-11(17-9(8)4-2)14-6-5-10(15)13-12(14)16/h1-2,5-6,8-9,11H,7H2,(H,13,15,16)/t8-,9+,11+/m0/s1 |
| InChIKey | NXKTYMVVRGZKGJ-IQJOONFLSA-N |
| XLogP | -0.29 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|