C16H18N2O8P+ — CID 123991489
[5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-oxo-phenoxyphosphanium (PubChem CID 123991489) has the molecular formula C16H18N2O8P+ and a molecular weight of 397.30 g/mol. Its IUPAC name is [5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-oxo-phenoxyphosphanium.
| Compound Name | [5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-oxo-phenoxyphosphanium |
|---|---|
| PubChem CID | 123991489 |
| Molecular Formula | C16H18N2O8P+ |
| Molecular Weight | 397.30 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | [5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-oxo-phenoxyphosphanium |
| SMILES | CC1(O)C(O)C(CO[P+](=O)Oc2ccccc2)OC1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C16H17N2O8P/c1-16(22)13(20)11(9-24-27(23)26-10-5-3-2-4-6-10)25-14(16)18-8-7-12(19)17-15(18)21/h2-8,11,13-14,20,22H,9H2,1H3/p+1 |
| InChIKey | YVDCHYWOXDPBBZ-UHFFFAOYSA-O |
| XLogP | 0.30 |
| TPSA | 140.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.30 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|