C14H23N2O5P — CID 118476572
1-[(2R,3S,4R,5R)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-3,4-dihydroxy-3-methyloxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 118476572) has the molecular formula C14H23N2O5P and a molecular weight of 330.32 g/mol. Its IUPAC name is 1-[(2R,3S,4R,5R)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-3,4-dihydroxy-3-methyloxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3S,4R,5R)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-3,4-dihydroxy-3-methyloxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 118476572 |
| Molecular Formula | C14H23N2O5P |
| Molecular Weight | 330.32 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 1-[(2R,3S,4R,5R)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-3,4-dihydroxy-3-methyloxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | C=P(C)(C)CC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@@](C)(O)[C@@H]1O |
| InChI | InChI=1S/C14H23N2O5P/c1-14(20)11(18)9(6-8-22(2,3)4)21-12(14)16-7-5-10(17)15-13(16)19/h5,7,9,11-12,18,20H,2,6,8H2,1,3-4H3,(H,15,17,19)/t9-,11-,12-,14+/m1/s1 |
| InChIKey | VXMICCVUWZWPND-LHMODEAPSA-N |
| XLogP | -0.35 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.32 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|