C16H16F2N2O6P+ — CID 168886375
[(2S,3S,5R)-2,3-difluoro-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-oxo-phenoxyphosphanium (PubChem CID 168886375) has the molecular formula C16H16F2N2O6P+ and a molecular weight of 401.28 g/mol. Its IUPAC name is [(2S,3S,5R)-2,3-difluoro-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-oxo-phenoxyphosphanium.
| Compound Name | [(2S,3S,5R)-2,3-difluoro-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-oxo-phenoxyphosphanium |
|---|---|
| PubChem CID | 168886375 |
| Molecular Formula | C16H16F2N2O6P+ |
| Molecular Weight | 401.28 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | [(2S,3S,5R)-2,3-difluoro-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-oxo-phenoxyphosphanium |
| SMILES | Cc1cn([C@H]2C[C@H](F)[C@@](F)(CO[P+](=O)Oc3ccccc3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H15F2N2O6P/c1-10-8-20(15(22)19-14(10)21)13-7-12(17)16(18,25-13)9-24-27(23)26-11-5-3-2-4-6-11/h2-6,8,12-13H,7,9H2,1H3/p+1/t12-,13+,16+/m0/s1 |
| InChIKey | ZWNLXGQEOPEPSL-WOSRLPQWSA-O |
| XLogP | 2.52 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.28 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|