C10H12F2N2O3S — CID 168886402
1-[(2R,4S,5S)-4,5-difluoro-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-4-sulfanylidenepyrimidin-2-one (PubChem CID 168886402) has the molecular formula C10H12F2N2O3S and a molecular weight of 278.28 g/mol. Its IUPAC name is 1-[(2R,4S,5S)-4,5-difluoro-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-4-sulfanylidenepyrimidin-2-one.
| Compound Name | 1-[(2R,4S,5S)-4,5-difluoro-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-4-sulfanylidenepyrimidin-2-one |
|---|---|
| PubChem CID | 168886402 |
| Molecular Formula | C10H12F2N2O3S |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 1-[(2R,4S,5S)-4,5-difluoro-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-4-sulfanylidenepyrimidin-2-one |
| SMILES | Cc1cn([C@H]2C[C@H](F)[C@@](F)(CO)O2)c(=O)[nH]c1=S |
| InChI | InChI=1S/C10H12F2N2O3S/c1-5-3-14(9(16)13-8(5)18)7-2-6(11)10(12,4-15)17-7/h3,6-7,15H,2,4H2,1H3,(H,13,16,18)/t6-,7+,10+/m0/s1 |
| InChIKey | HYYQAAOYBOWOSH-NYNCVSEMSA-N |
| XLogP | 1.13 |
| TPSA | 67.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|