C23H26ClFN5O7P — CID 16756967
9-[(3aR,4R,6R,6aR)-6-[[4-(4-chloro-3-fluorophenyl)-2-oxo-1,3,2lambda5-dioxaphosphinan-2-yl]oxymethyl]-2,2,3a-trimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-4-yl]purin-6-amine (PubChem CID 16756967) has the molecular formula C23H26ClFN5O7P and a molecular weight of 569.91 g/mol. Its IUPAC name is 9-[(3aR,4R,6R,6aR)-6-[[4-(4-chloro-3-fluorophenyl)-2-oxo-1,3,2lambda5-dioxaphosphinan-2-yl]oxymethyl]-2,2,3a-trimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-4-yl]purin-6-amine.
| Compound Name | 9-[(3aR,4R,6R,6aR)-6-[[4-(4-chloro-3-fluorophenyl)-2-oxo-1,3,2lambda5-dioxaphosphinan-2-yl]oxymethyl]-2,2,3a-trimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-4-yl]purin-6-amine |
|---|---|
| PubChem CID | 16756967 |
| Molecular Formula | C23H26ClFN5O7P |
| Molecular Weight | 569.91 g/mol |
| Exact Mass | 569.12 |
| IUPAC Name | 9-[(3aR,4R,6R,6aR)-6-[[4-(4-chloro-3-fluorophenyl)-2-oxo-1,3,2lambda5-dioxaphosphinan-2-yl]oxymethyl]-2,2,3a-trimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-4-yl]purin-6-amine |
| SMILES | CC1(C)O[C@@H]2[C@@H](COP3(=O)OCCC(c4ccc(Cl)c(F)c4)O3)O[C@@H](n3cnc4c(N)ncnc43)[C@]2(C)O1 |
| InChI | InChI=1S/C23H26ClFN5O7P/c1-22(2)35-18-16(9-33-38(31)32-7-6-15(36-38)12-4-5-13(24)14(25)8-12)34-21(23(18,3)37-22)30-11-29-17-19(26)27-10-28-20(17)30/h4-5,8,10-11,15-16,18,21H,6-7,9H2,1-3H3,(H2,26,27,28)/t15?,16-,18-,21-,23-,38?/m1/s1 |
| InChIKey | VEKKQTCCXCFDRZ-XXOLTBLZSA-N |
| XLogP | 4.31 |
| TPSA | 142.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.91 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|