C11H16N5O8P — CID 172561110
[(2R,3R,4S,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-(hydroxymethyl)-4-methoxyoxolan-3-yl] dihydrogen phosphate (PubChem CID 172561110) has the molecular formula C11H16N5O8P and a molecular weight of 377.25 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-(hydroxymethyl)-4-methoxyoxolan-3-yl] dihydrogen phosphate.
| Compound Name | [(2R,3R,4S,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-(hydroxymethyl)-4-methoxyoxolan-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 172561110 |
| Molecular Formula | C11H16N5O8P |
| Molecular Weight | 377.25 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | [(2R,3R,4S,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-(hydroxymethyl)-4-methoxyoxolan-3-yl] dihydrogen phosphate |
| SMILES | CO[C@@]1(O)[C@H](OP(=O)(O)O)[C@@H](CO)O[C@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C11H16N5O8P/c1-22-11(18)7(24-25(19,20)21)5(2-17)23-10(11)16-4-15-6-8(12)13-3-14-9(6)16/h3-5,7,10,17-18H,2H2,1H3,(H2,12,13,14)(H2,19,20,21)/t5-,7-,10-,11+/m1/s1 |
| InChIKey | NRXUSJRJASZSDJ-OFBQIVOGSA-N |
| XLogP | -1.89 |
| TPSA | 195.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.25 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|