C24H31N6O8PS — CID 143412563
9-[3-methyl-5-[[5-(3-morpholin-4-ylsulfonylphenyl)-1,2,4,3-trioxaphosphepan-3-yl]oxymethyl]oxolan-2-yl]purin-6-amine (PubChem CID 143412563) has the molecular formula C24H31N6O8PS and a molecular weight of 594.59 g/mol. Its IUPAC name is 9-[3-methyl-5-[[5-(3-morpholin-4-ylsulfonylphenyl)-1,2,4,3-trioxaphosphepan-3-yl]oxymethyl]oxolan-2-yl]purin-6-amine.
| Compound Name | 9-[3-methyl-5-[[5-(3-morpholin-4-ylsulfonylphenyl)-1,2,4,3-trioxaphosphepan-3-yl]oxymethyl]oxolan-2-yl]purin-6-amine |
|---|---|
| PubChem CID | 143412563 |
| Molecular Formula | C24H31N6O8PS |
| Molecular Weight | 594.59 g/mol |
| Exact Mass | 594.17 |
| IUPAC Name | 9-[3-methyl-5-[[5-(3-morpholin-4-ylsulfonylphenyl)-1,2,4,3-trioxaphosphepan-3-yl]oxymethyl]oxolan-2-yl]purin-6-amine |
| SMILES | CC1CC(COP2OOCCC(c3cccc(S(=O)(=O)N4CCOCC4)c3)O2)OC1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C24H31N6O8PS/c1-16-11-18(36-24(16)30-15-28-21-22(25)26-14-27-23(21)30)13-35-39-37-20(5-8-34-38-39)17-3-2-4-19(12-17)40(31,32)29-6-9-33-10-7-29/h2-4,12,14-16,18,20,24H,5-11,13H2,1H3,(H2,25,26,27) |
| InChIKey | BBMQULZUVDJYHJ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 162.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.59 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|