C19H22N5O6PS — CID 154983793
(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[4-(3-methylphenyl)-2-sulfanylidene-1,3,2λ5-dioxaphospholan-2-yl]oxymethyl]oxolane-3,4-diol (PubChem CID 154983793) has the molecular formula C19H22N5O6PS and a molecular weight of 479.46 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[4-(3-methylphenyl)-2-sulfanylidene-1,3,2λ5-dioxaphospholan-2-yl]oxymethyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[4-(3-methylphenyl)-2-sulfanylidene-1,3,2λ5-dioxaphospholan-2-yl]oxymethyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 154983793 |
| Molecular Formula | C19H22N5O6PS |
| Molecular Weight | 479.46 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[4-(3-methylphenyl)-2-sulfanylidene-1,3,2λ5-dioxaphospholan-2-yl]oxymethyl]oxolane-3,4-diol |
| SMILES | Cc1cccc(C2COP(=S)(OC[C@H]3O[C@@H](n4cnc5c(N)ncnc54)[C@H](O)[C@@H]3O)O2)c1 |
| InChI | InChI=1S/C19H22N5O6PS/c1-10-3-2-4-11(5-10)12-6-27-31(32,30-12)28-7-13-15(25)16(26)19(29-13)24-9-23-14-17(20)21-8-22-18(14)24/h2-5,8-9,12-13,15-16,19,25-26H,6-7H2,1H3,(H2,20,21,22)/t12?,13-,15-,16-,19-,31?/m1/s1 |
| InChIKey | OOHHCPPXYPNURI-HUZFPMEBSA-N |
| XLogP | 1.37 |
| TPSA | 147.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.46 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|