C18H18Cl2N5O6PS — CID 154983802
(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[4-(2,5-dichlorophenyl)-2-sulfanylidene-1,3,2λ5-dioxaphospholan-2-yl]oxymethyl]oxolane-3,4-diol (PubChem CID 154983802) has the molecular formula C18H18Cl2N5O6PS and a molecular weight of 534.32 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[4-(2,5-dichlorophenyl)-2-sulfanylidene-1,3,2λ5-dioxaphospholan-2-yl]oxymethyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[4-(2,5-dichlorophenyl)-2-sulfanylidene-1,3,2λ5-dioxaphospholan-2-yl]oxymethyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 154983802 |
| Molecular Formula | C18H18Cl2N5O6PS |
| Molecular Weight | 534.32 g/mol |
| Exact Mass | 533.01 |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[4-(2,5-dichlorophenyl)-2-sulfanylidene-1,3,2λ5-dioxaphospholan-2-yl]oxymethyl]oxolane-3,4-diol |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP2(=S)OCC(c3cc(Cl)ccc3Cl)O2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C18H18Cl2N5O6PS/c19-8-1-2-10(20)9(3-8)11-4-28-32(33,31-11)29-5-12-14(26)15(27)18(30-12)25-7-24-13-16(21)22-6-23-17(13)25/h1-3,6-7,11-12,14-15,18,26-27H,4-5H2,(H2,21,22,23)/t11?,12-,14-,15-,18-,32?/m1/s1 |
| InChIKey | XJRMSAKSOCNPPX-WERWXRPSSA-N |
| XLogP | 2.36 |
| TPSA | 147.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.32 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|